C30H35Cl2N3O4S — CID 58651294
N-[3-[1-[(3S)-3-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-3-phenylpropyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 58651294) has the molecular formula C30H35Cl2N3O4S and a molecular weight of 604.60 g/mol. Its IUPAC name is N-[3-[1-[(3S)-3-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-3-phenylpropyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[(3S)-3-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-3-phenylpropyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 58651294 |
| Molecular Formula | C30H35Cl2N3O4S |
| Molecular Weight | 604.60 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | N-[3-[1-[(3S)-3-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-3-phenylpropyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(CC[C@H](NS(=O)(=O)c3cc(Cl)cc(Cl)c3O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C30H35Cl2N3O4S/c1-20(2)30(37)33-25-10-6-9-23(17-25)21-11-14-35(15-12-21)16-13-27(22-7-4-3-5-8-22)34-40(38,39)28-19-24(31)18-26(32)29(28)36/h3-10,17-21,27,34,36H,11-16H2,1-2H3,(H,33,37)/t27-/m0/s1 |
| InChIKey | KVFYBGBUSLSYIJ-MHZLTWQESA-N |
| XLogP | 6.58 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.60 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|