C26H33FN2O2 — CID 22049378
N-[3-[1-[5-(4-fluorophenyl)-5-oxopentyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 22049378) has the molecular formula C26H33FN2O2 and a molecular weight of 424.56 g/mol. Its IUPAC name is N-[3-[1-[5-(4-fluorophenyl)-5-oxopentyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[5-(4-fluorophenyl)-5-oxopentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 22049378 |
| Molecular Formula | C26H33FN2O2 |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | N-[3-[1-[5-(4-fluorophenyl)-5-oxopentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(CCCCC(=O)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C26H33FN2O2/c1-19(2)26(31)28-24-7-5-6-22(18-24)20-13-16-29(17-14-20)15-4-3-8-25(30)21-9-11-23(27)12-10-21/h5-7,9-12,18-20H,3-4,8,13-17H2,1-2H3,(H,28,31) |
| InChIKey | BJIMYZVEFDZDSR-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|