C34H41FN2O3 — CID 22048891
N-[3-[1-[5-(3-acetylphenoxy)-5-(4-fluorophenyl)pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 22048891) has the molecular formula C34H41FN2O3 and a molecular weight of 544.71 g/mol. Its IUPAC name is N-[3-[1-[5-(3-acetylphenoxy)-5-(4-fluorophenyl)pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[5-(3-acetylphenoxy)-5-(4-fluorophenyl)pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 22048891 |
| Molecular Formula | C34H41FN2O3 |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | N-[3-[1-[5-(3-acetylphenoxy)-5-(4-fluorophenyl)pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(=O)c1cccc(OC(CCCCN2CCC(c3cccc(NC(=O)C(C)C)c3)CC2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C34H41FN2O3/c1-24(2)34(39)36-31-10-6-9-29(22-31)26-17-20-37(21-18-26)19-5-4-12-33(27-13-15-30(35)16-14-27)40-32-11-7-8-28(23-32)25(3)38/h6-11,13-16,22-24,26,33H,4-5,12,17-21H2,1-3H3,(H,36,39) |
| InChIKey | XNWULANTGPWWQE-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|