C34H43FN2O3 — CID 22049398
N-[3-[1-[6-(2-fluorophenyl)-6-(2-methoxyphenoxy)hexyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 22049398) has the molecular formula C34H43FN2O3 and a molecular weight of 546.73 g/mol. Its IUPAC name is N-[3-[1-[6-(2-fluorophenyl)-6-(2-methoxyphenoxy)hexyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[6-(2-fluorophenyl)-6-(2-methoxyphenoxy)hexyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 22049398 |
| Molecular Formula | C34H43FN2O3 |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | N-[3-[1-[6-(2-fluorophenyl)-6-(2-methoxyphenoxy)hexyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | COc1ccccc1OC(CCCCCN1CCC(c2cccc(NC(=O)C(C)C)c2)CC1)c1ccccc1F |
| InChI | InChI=1S/C34H43FN2O3/c1-25(2)34(38)36-28-13-11-12-27(24-28)26-19-22-37(23-20-26)21-10-4-5-16-31(29-14-6-7-15-30(29)35)40-33-18-9-8-17-32(33)39-3/h6-9,11-15,17-18,24-26,31H,4-5,10,16,19-23H2,1-3H3,(H,36,38) |
| InChIKey | XFZITJVZDKLUBG-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|