C33H37ClF4N2O2 — CID 22049052
N-[3-[1-[5-(3-chlorophenyl)-5-[2-fluoro-5-(trifluoromethyl)phenoxy]pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 22049052) has the molecular formula C33H37ClF4N2O2 and a molecular weight of 605.12 g/mol. Its IUPAC name is N-[3-[1-[5-(3-chlorophenyl)-5-[2-fluoro-5-(trifluoromethyl)phenoxy]pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[5-(3-chlorophenyl)-5-[2-fluoro-5-(trifluoromethyl)phenoxy]pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 22049052 |
| Molecular Formula | C33H37ClF4N2O2 |
| Molecular Weight | 605.12 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | N-[3-[1-[5-(3-chlorophenyl)-5-[2-fluoro-5-(trifluoromethyl)phenoxy]pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(CCCCC(Oc3cc(C(F)(F)F)ccc3F)c3cccc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C33H37ClF4N2O2/c1-22(2)32(41)39-28-10-6-7-24(20-28)23-14-17-40(18-15-23)16-4-3-11-30(25-8-5-9-27(34)19-25)42-31-21-26(33(36,37)38)12-13-29(31)35/h5-10,12-13,19-23,30H,3-4,11,14-18H2,1-2H3,(H,39,41) |
| InChIKey | FTTXQBWDJLDFCG-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.12 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|