C29H30F5NO — CID 141081623
1-[5-(3-fluorophenyl)-5-[2-fluoro-5-(trifluoromethyl)phenoxy]pentyl]-4-phenylpiperidine (PubChem CID 141081623) has the molecular formula C29H30F5NO and a molecular weight of 503.56 g/mol. Its IUPAC name is 1-[5-(3-fluorophenyl)-5-[2-fluoro-5-(trifluoromethyl)phenoxy]pentyl]-4-phenylpiperidine.
| Compound Name | 1-[5-(3-fluorophenyl)-5-[2-fluoro-5-(trifluoromethyl)phenoxy]pentyl]-4-phenylpiperidine |
|---|---|
| PubChem CID | 141081623 |
| Molecular Formula | C29H30F5NO |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 1-[5-(3-fluorophenyl)-5-[2-fluoro-5-(trifluoromethyl)phenoxy]pentyl]-4-phenylpiperidine |
| SMILES | Fc1cccc(C(CCCCN2CCC(c3ccccc3)CC2)Oc2cc(C(F)(F)F)ccc2F)c1 |
| InChI | InChI=1S/C29H30F5NO/c30-25-10-6-9-23(19-25)27(36-28-20-24(29(32,33)34)12-13-26(28)31)11-4-5-16-35-17-14-22(15-18-35)21-7-2-1-3-8-21/h1-3,6-10,12-13,19-20,22,27H,4-5,11,14-18H2 |
| InChIKey | OCRUYTWISKQIFL-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|