C24H27F3N2 — CID 70542429
3-[4-(4-phenylpiperidin-1-yl)butyl]-5-(trifluoromethyl)-1H-indole (PubChem CID 70542429) has the molecular formula C24H27F3N2 and a molecular weight of 400.49 g/mol. Its IUPAC name is 3-[4-(4-phenylpiperidin-1-yl)butyl]-5-(trifluoromethyl)-1H-indole.
| Compound Name | 3-[4-(4-phenylpiperidin-1-yl)butyl]-5-(trifluoromethyl)-1H-indole |
|---|---|
| PubChem CID | 70542429 |
| Molecular Formula | C24H27F3N2 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 3-[4-(4-phenylpiperidin-1-yl)butyl]-5-(trifluoromethyl)-1H-indole |
| SMILES | FC(F)(F)c1ccc2[nH]cc(CCCCN3CCC(c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C24H27F3N2/c25-24(26,27)21-9-10-23-22(16-21)20(17-28-23)8-4-5-13-29-14-11-19(12-15-29)18-6-2-1-3-7-18/h1-3,6-7,9-10,16-17,19,28H,4-5,8,11-15H2 |
| InChIKey | LHXBWGGMOUGOEY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|