C26H32ClN3O — CID 131720346
3-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-5-methoxy-1H-indole;hydrochloride (PubChem CID 131720346) has the molecular formula C26H32ClN3O and a molecular weight of 438.02 g/mol. Its IUPAC name is 3-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-5-methoxy-1H-indole;hydrochloride.
| Compound Name | 3-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-5-methoxy-1H-indole;hydrochloride |
|---|---|
| PubChem CID | 131720346 |
| Molecular Formula | C26H32ClN3O |
| Molecular Weight | 438.02 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 3-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-5-methoxy-1H-indole;hydrochloride |
| SMILES | COc1ccc2[nH]cc(CCCCN3CCC(c4c[nH]c5ccccc45)CC3)c2c1.Cl |
| InChI | InChI=1S/C26H31N3O.ClH/c1-30-21-9-10-26-23(16-21)20(17-27-26)6-4-5-13-29-14-11-19(12-15-29)24-18-28-25-8-3-2-7-22(24)25;/h2-3,7-10,16-19,27-28H,4-6,11-15H2,1H3;1H |
| InChIKey | NJEWSQBULBSVNK-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 44.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.02 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|