C27H30N4O2 — CID 22909402
N-[3-[4-(6-methoxy-1H-indol-3-yl)piperidin-1-yl]propyl]isoquinoline-1-carboxamide (PubChem CID 22909402) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-[3-[4-(6-methoxy-1H-indol-3-yl)piperidin-1-yl]propyl]isoquinoline-1-carboxamide.
| Compound Name | N-[3-[4-(6-methoxy-1H-indol-3-yl)piperidin-1-yl]propyl]isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 22909402 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | N-[3-[4-(6-methoxy-1H-indol-3-yl)piperidin-1-yl]propyl]isoquinoline-1-carboxamide |
| SMILES | COc1ccc2c(C3CCN(CCCNC(=O)c4nccc5ccccc45)CC3)c[nH]c2c1 |
| InChI | InChI=1S/C27H30N4O2/c1-33-21-7-8-23-24(18-30-25(23)17-21)20-10-15-31(16-11-20)14-4-12-29-27(32)26-22-6-3-2-5-19(22)9-13-28-26/h2-3,5-9,13,17-18,20,30H,4,10-12,14-16H2,1H3,(H,29,32) |
| InChIKey | JNKMITHUMIWCJQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|