C27H27N5O — CID 22909477
N-[3-[4-(4-cyano-1H-indol-3-yl)piperidin-1-yl]propyl]quinoline-4-carboxamide (PubChem CID 22909477) has the molecular formula C27H27N5O and a molecular weight of 437.55 g/mol. Its IUPAC name is N-[3-[4-(4-cyano-1H-indol-3-yl)piperidin-1-yl]propyl]quinoline-4-carboxamide.
| Compound Name | N-[3-[4-(4-cyano-1H-indol-3-yl)piperidin-1-yl]propyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 22909477 |
| Molecular Formula | C27H27N5O |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | N-[3-[4-(4-cyano-1H-indol-3-yl)piperidin-1-yl]propyl]quinoline-4-carboxamide |
| SMILES | N#Cc1cccc2[nH]cc(C3CCN(CCCNC(=O)c4ccnc5ccccc45)CC3)c12 |
| InChI | InChI=1S/C27H27N5O/c28-17-20-5-3-8-25-26(20)23(18-31-25)19-10-15-32(16-11-19)14-4-12-30-27(33)22-9-13-29-24-7-2-1-6-21(22)24/h1-3,5-9,13,18-19,31H,4,10-12,14-16H2,(H,30,33) |
| InChIKey | OQBUVYARMNYZTH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|