C26H27ClN4O — CID 22909497
N-[3-[4-(5-chloro-1H-indol-3-yl)piperidin-1-yl]propyl]isoquinoline-1-carboxamide (PubChem CID 22909497) has the molecular formula C26H27ClN4O and a molecular weight of 446.98 g/mol. Its IUPAC name is N-[3-[4-(5-chloro-1H-indol-3-yl)piperidin-1-yl]propyl]isoquinoline-1-carboxamide.
| Compound Name | N-[3-[4-(5-chloro-1H-indol-3-yl)piperidin-1-yl]propyl]isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 22909497 |
| Molecular Formula | C26H27ClN4O |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | N-[3-[4-(5-chloro-1H-indol-3-yl)piperidin-1-yl]propyl]isoquinoline-1-carboxamide |
| SMILES | O=C(NCCCN1CCC(c2c[nH]c3ccc(Cl)cc23)CC1)c1nccc2ccccc12 |
| InChI | InChI=1S/C26H27ClN4O/c27-20-6-7-24-22(16-20)23(17-30-24)19-9-14-31(15-10-19)13-3-11-29-26(32)25-21-5-2-1-4-18(21)8-12-28-25/h1-2,4-8,12,16-17,19,30H,3,9-11,13-15H2,(H,29,32) |
| InChIKey | CSRMSLSPZZYMJT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|