C20H26ClN3O — CID 113087497
4-(5-chloro-1H-indol-3-yl)-N-cyclohexylpiperidine-1-carboxamide (PubChem CID 113087497) has the molecular formula C20H26ClN3O and a molecular weight of 359.90 g/mol. Its IUPAC name is 4-(5-chloro-1H-indol-3-yl)-N-cyclohexylpiperidine-1-carboxamide.
| Compound Name | 4-(5-chloro-1H-indol-3-yl)-N-cyclohexylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 113087497 |
| Molecular Formula | C20H26ClN3O |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 4-(5-chloro-1H-indol-3-yl)-N-cyclohexylpiperidine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCC(c2c[nH]c3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C20H26ClN3O/c21-15-6-7-19-17(12-15)18(13-22-19)14-8-10-24(11-9-14)20(25)23-16-4-2-1-3-5-16/h6-7,12-14,16,22H,1-5,8-11H2,(H,23,25) |
| InChIKey | FNRRCEQDYPCCEQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |