C14H14ClNO — CID 18414110
4-(5-chloro-1H-indol-3-yl)cyclohexan-1-one (PubChem CID 18414110) has the molecular formula C14H14ClNO and a molecular weight of 247.72 g/mol. Its IUPAC name is 4-(5-chloro-1H-indol-3-yl)cyclohexan-1-one.
| Compound Name | 4-(5-chloro-1H-indol-3-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 18414110 |
| Molecular Formula | C14H14ClNO |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-(5-chloro-1H-indol-3-yl)cyclohexan-1-one |
| SMILES | O=C1CCC(c2c[nH]c3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C14H14ClNO/c15-10-3-6-14-12(7-10)13(8-16-14)9-1-4-11(17)5-2-9/h3,6-9,16H,1-2,4-5H2 |
| InChIKey | ZWIKMLAXFAMGDE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |