C15H16ClNO — CID 7353942
trans-(2S,5R)-2-(5-chloro-1H-indol-3-yl)-5-methylcyclohexan-1-one (PubChem CID 7353942) has the molecular formula C15H16ClNO and a molecular weight of 261.75 g/mol. Its IUPAC name is trans-(2S,5R)-2-(5-chloro-1H-indol-3-yl)-5-methylcyclohexan-1-one.
| Compound Name | trans-(2S,5R)-2-(5-chloro-1H-indol-3-yl)-5-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 7353942 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | trans-(2S,5R)-2-(5-chloro-1H-indol-3-yl)-5-methylcyclohexan-1-one |
| SMILES | C[C@@H]1CC[C@@H](c2c[nH]c3ccc(Cl)cc23)C(=O)C1 |
| InChI | InChI=1S/C15H16ClNO/c1-9-2-4-11(15(18)6-9)13-8-17-14-5-3-10(16)7-12(13)14/h3,5,7-9,11,17H,2,4,6H2,1H3/t9-,11+/m1/s1 |
| InChIKey | AAUCUKYTWAGRNG-KOLCDFICSA-N |
| XLogP | 4.29 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |