C12H10FNO — CID 162402410
2-(5-fluoro-1H-indol-3-yl)cyclobutan-1-one (PubChem CID 162402410) has the molecular formula C12H10FNO and a molecular weight of 203.22 g/mol. Its IUPAC name is 2-(5-fluoro-1H-indol-3-yl)cyclobutan-1-one.
| Compound Name | 2-(5-fluoro-1H-indol-3-yl)cyclobutan-1-one |
|---|---|
| PubChem CID | 162402410 |
| Molecular Formula | C12H10FNO |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 2-(5-fluoro-1H-indol-3-yl)cyclobutan-1-one |
| SMILES | O=C1CCC1c1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C12H10FNO/c13-7-1-3-11-9(5-7)10(6-14-11)8-2-4-12(8)15/h1,3,5-6,8,14H,2,4H2 |
| InChIKey | LJHDWIORANZCSU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |