C27H26F2N4O2 — CID 155535386
3-(5-fluoro-1H-indol-3-yl)-1-[2-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]ethyl]pyrrolidine-2,5-dione (PubChem CID 155535386) has the molecular formula C27H26F2N4O2 and a molecular weight of 476.53 g/mol. Its IUPAC name is 3-(5-fluoro-1H-indol-3-yl)-1-[2-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-(5-fluoro-1H-indol-3-yl)-1-[2-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 155535386 |
| Molecular Formula | C27H26F2N4O2 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 3-(5-fluoro-1H-indol-3-yl)-1-[2-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]ethyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2c[nH]c3ccc(F)cc23)C(=O)N1CCN1CCC(c2c[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C27H26F2N4O2/c28-17-1-3-24-19(11-17)22(14-30-24)16-5-7-32(8-6-16)9-10-33-26(34)13-21(27(33)35)23-15-31-25-4-2-18(29)12-20(23)25/h1-4,11-12,14-16,21,30-31H,5-10,13H2 |
| InChIKey | XYELHMUZUMBCJJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|