C30H33FN4O3 — CID 155524228
3-(5-fluoro-1H-indol-3-yl)-1-[4-[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]butyl]pyrrolidine-2,5-dione (PubChem CID 155524228) has the molecular formula C30H33FN4O3 and a molecular weight of 516.62 g/mol. Its IUPAC name is 3-(5-fluoro-1H-indol-3-yl)-1-[4-[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]butyl]pyrrolidine-2,5-dione.
| Compound Name | 3-(5-fluoro-1H-indol-3-yl)-1-[4-[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]butyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 155524228 |
| Molecular Formula | C30H33FN4O3 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 3-(5-fluoro-1H-indol-3-yl)-1-[4-[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]butyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2[nH]cc(C3CCN(CCCCN4C(=O)CC(c5c[nH]c6ccc(F)cc56)C4=O)CC3)c2c1 |
| InChI | InChI=1S/C30H33FN4O3/c1-38-21-5-7-28-23(15-21)25(17-32-28)19-8-12-34(13-9-19)10-2-3-11-35-29(36)16-24(30(35)37)26-18-33-27-6-4-20(31)14-22(26)27/h4-7,14-15,17-19,24,32-33H,2-3,8-13,16H2,1H3 |
| InChIKey | RLCMAMKDJBORHF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|