C26H30FN3OS — CID 10182471
5-[5-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]pentoxy]-2-methyl-1,3-benzothiazole (PubChem CID 10182471) has the molecular formula C26H30FN3OS and a molecular weight of 451.61 g/mol. Its IUPAC name is 5-[5-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]pentoxy]-2-methyl-1,3-benzothiazole.
| Compound Name | 5-[5-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]pentoxy]-2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 10182471 |
| Molecular Formula | C26H30FN3OS |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 5-[5-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]pentoxy]-2-methyl-1,3-benzothiazole |
| SMILES | Cc1nc2cc(OCCCCCN3CCC(c4c[nH]c5ccc(F)cc45)CC3)ccc2s1 |
| InChI | InChI=1S/C26H30FN3OS/c1-18-29-25-16-21(6-8-26(25)32-18)31-14-4-2-3-11-30-12-9-19(10-13-30)23-17-28-24-7-5-20(27)15-22(23)24/h5-8,15-17,19,28H,2-4,9-14H2,1H3 |
| InChIKey | XIFURTRASNYFCM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|