C24H26FN3OS — CID 10180659
5-[3-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]propoxy]-2-methyl-1,3-benzothiazole (PubChem CID 10180659) has the molecular formula C24H26FN3OS and a molecular weight of 423.56 g/mol. Its IUPAC name is 5-[3-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]propoxy]-2-methyl-1,3-benzothiazole.
| Compound Name | 5-[3-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]propoxy]-2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 10180659 |
| Molecular Formula | C24H26FN3OS |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 5-[3-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]propoxy]-2-methyl-1,3-benzothiazole |
| SMILES | Cc1nc2cc(OCCCN3CCC(c4c[nH]c5ccc(F)cc45)CC3)ccc2s1 |
| InChI | InChI=1S/C24H26FN3OS/c1-16-27-23-14-19(4-6-24(23)30-16)29-12-2-9-28-10-7-17(8-11-28)21-15-26-22-5-3-18(25)13-20(21)22/h3-6,13-15,17,26H,2,7-12H2,1H3 |
| InChIKey | AMFMGTCVZJUNNC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|