C23H25N3O — CID 10109123
3-[1-(3-phenoxypropyl)piperidin-4-yl]-1H-indole-5-carbonitrile (PubChem CID 10109123) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-[1-(3-phenoxypropyl)piperidin-4-yl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[1-(3-phenoxypropyl)piperidin-4-yl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 10109123 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 3-[1-(3-phenoxypropyl)piperidin-4-yl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(C3CCN(CCCOc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C23H25N3O/c24-16-18-7-8-23-21(15-18)22(17-25-23)19-9-12-26(13-10-19)11-4-14-27-20-5-2-1-3-6-20/h1-3,5-8,15,17,19,25H,4,9-14H2 |
| InChIKey | QREZYWRVHCYZSR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|