C30H37N3O3S — CID 70152814
5-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)-4-(5-methoxy-1H-indol-3-yl)butoxy]butoxy]-2-methyl-1,3-benzothiazole (PubChem CID 70152814) has the molecular formula C30H37N3O3S and a molecular weight of 519.71 g/mol. Its IUPAC name is 5-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)-4-(5-methoxy-1H-indol-3-yl)butoxy]butoxy]-2-methyl-1,3-benzothiazole.
| Compound Name | 5-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)-4-(5-methoxy-1H-indol-3-yl)butoxy]butoxy]-2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 70152814 |
| Molecular Formula | C30H37N3O3S |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 5-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)-4-(5-methoxy-1H-indol-3-yl)butoxy]butoxy]-2-methyl-1,3-benzothiazole |
| SMILES | COc1ccc2[nH]cc(C(CCCOCCCCOc3ccc4sc(C)nc4c3)N3CC=CCC3)c2c1 |
| InChI | InChI=1S/C30H37N3O3S/c1-22-32-28-20-24(11-13-30(28)37-22)36-18-7-6-16-35-17-8-9-29(33-14-4-3-5-15-33)26-21-31-27-12-10-23(34-2)19-25(26)27/h3-4,10-13,19-21,29,31H,5-9,14-18H2,1-2H3 |
| InChIKey | XWUKVCXQFDTGIM-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|