C25H28FN3O2 — CID 12992366
4-[4-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]butyl]-1,4-benzoxazin-3-one (PubChem CID 12992366) has the molecular formula C25H28FN3O2 and a molecular weight of 421.52 g/mol. Its IUPAC name is 4-[4-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]butyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[4-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]butyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 12992366 |
| Molecular Formula | C25H28FN3O2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 4-[4-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]butyl]-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccccc2N1CCCCN1CCC(c2c[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C25H28FN3O2/c26-19-7-8-22-20(15-19)21(16-27-22)18-9-13-28(14-10-18)11-3-4-12-29-23-5-1-2-6-24(23)31-17-25(29)30/h1-2,5-8,15-16,18,27H,3-4,9-14,17H2 |
| InChIKey | SHOFJJYJPCUKIL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|