C26H32FN3O — CID 23030999
2-[4-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]butyl]-1-oxido-1,2,3,4-tetrahydroquinolin-1-ium (PubChem CID 23030999) has the molecular formula C26H32FN3O and a molecular weight of 421.56 g/mol. Its IUPAC name is 2-[4-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]butyl]-1-oxido-1,2,3,4-tetrahydroquinolin-1-ium.
| Compound Name | 2-[4-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]butyl]-1-oxido-1,2,3,4-tetrahydroquinolin-1-ium |
|---|---|
| PubChem CID | 23030999 |
| Molecular Formula | C26H32FN3O |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 2-[4-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]butyl]-1-oxido-1,2,3,4-tetrahydroquinolin-1-ium |
| SMILES | [O-][NH+]1c2ccccc2CCC1CCCCN1CCC(c2c[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C26H32FN3O/c27-21-9-11-25-23(17-21)24(18-28-25)19-12-15-29(16-13-19)14-4-3-6-22-10-8-20-5-1-2-7-26(20)30(22)31/h1-2,5,7,9,11,17-19,22,28,30H,3-4,6,8,10,12-16H2 |
| InChIKey | QNDWFQDMMOLGBJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|