C27H28ClFN2O4 — CID 18545878
(E)-but-2-enedioic acid;3-[1-[(6-chloro-2,3-dihydro-1H-inden-1-yl)methyl]piperidin-4-yl]-5-fluoro-1H-indole (PubChem CID 18545878) has the molecular formula C27H28ClFN2O4 and a molecular weight of 498.98 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-[1-[(6-chloro-2,3-dihydro-1H-inden-1-yl)methyl]piperidin-4-yl]-5-fluoro-1H-indole.
| Compound Name | (E)-but-2-enedioic acid;3-[1-[(6-chloro-2,3-dihydro-1H-inden-1-yl)methyl]piperidin-4-yl]-5-fluoro-1H-indole |
|---|---|
| PubChem CID | 18545878 |
| Molecular Formula | C27H28ClFN2O4 |
| Molecular Weight | 498.98 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | (E)-but-2-enedioic acid;3-[1-[(6-chloro-2,3-dihydro-1H-inden-1-yl)methyl]piperidin-4-yl]-5-fluoro-1H-indole |
| SMILES | Fc1ccc2[nH]cc(C3CCN(CC4CCc5ccc(Cl)cc54)CC3)c2c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H24ClFN2.C4H4O4/c24-18-4-3-15-1-2-17(20(15)11-18)14-27-9-7-16(8-10-27)22-13-26-23-6-5-19(25)12-21(22)23;5-3(6)1-2-4(7)8/h3-6,11-13,16-17,26H,1-2,7-10,14H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | UMLXRELJBMRMCP-WLHGVMLRSA-N |
| XLogP | 5.58 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.98 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|