C22H24ClN3S — CID 23504830
3-[[4-(5-chloro-1H-indol-3-yl)piperidin-1-yl]methyl]-2,3-dihydro-1-benzothiophen-5-amine (PubChem CID 23504830) has the molecular formula C22H24ClN3S and a molecular weight of 397.98 g/mol. Its IUPAC name is 3-[[4-(5-chloro-1H-indol-3-yl)piperidin-1-yl]methyl]-2,3-dihydro-1-benzothiophen-5-amine.
| Compound Name | 3-[[4-(5-chloro-1H-indol-3-yl)piperidin-1-yl]methyl]-2,3-dihydro-1-benzothiophen-5-amine |
|---|---|
| PubChem CID | 23504830 |
| Molecular Formula | C22H24ClN3S |
| Molecular Weight | 397.98 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 3-[[4-(5-chloro-1H-indol-3-yl)piperidin-1-yl]methyl]-2,3-dihydro-1-benzothiophen-5-amine |
| SMILES | Nc1ccc2c(c1)C(CN1CCC(c3c[nH]c4ccc(Cl)cc34)CC1)CS2 |
| InChI | InChI=1S/C22H24ClN3S/c23-16-1-3-21-19(9-16)20(11-25-21)14-5-7-26(8-6-14)12-15-13-27-22-4-2-17(24)10-18(15)22/h1-4,9-11,14-15,25H,5-8,12-13,24H2 |
| InChIKey | RDACROLUNSMJLW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.98 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|