C25H27ClN4 — CID 67754333
5-chloro-3-[1-[2-[1-(2-methylphenyl)pyrazol-4-yl]ethyl]piperidin-4-yl]-1H-indole (PubChem CID 67754333) has the molecular formula C25H27ClN4 and a molecular weight of 418.97 g/mol. Its IUPAC name is 5-chloro-3-[1-[2-[1-(2-methylphenyl)pyrazol-4-yl]ethyl]piperidin-4-yl]-1H-indole.
| Compound Name | 5-chloro-3-[1-[2-[1-(2-methylphenyl)pyrazol-4-yl]ethyl]piperidin-4-yl]-1H-indole |
|---|---|
| PubChem CID | 67754333 |
| Molecular Formula | C25H27ClN4 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 5-chloro-3-[1-[2-[1-(2-methylphenyl)pyrazol-4-yl]ethyl]piperidin-4-yl]-1H-indole |
| SMILES | Cc1ccccc1-n1cc(CCN2CCC(c3c[nH]c4ccc(Cl)cc34)CC2)cn1 |
| InChI | InChI=1S/C25H27ClN4/c1-18-4-2-3-5-25(18)30-17-19(15-28-30)8-11-29-12-9-20(10-13-29)23-16-27-24-7-6-21(26)14-22(23)24/h2-7,14-17,20,27H,8-13H2,1H3 |
| InChIKey | QZVUARBSOFNIQU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |