C25H30ClN3O — CID 10159346
4-[4-[4-(5-chloro-1H-indol-3-yl)piperidin-1-yl]butyl]-3,4-dihydro-2H-1,2-benzoxazine (PubChem CID 10159346) has the molecular formula C25H30ClN3O and a molecular weight of 423.99 g/mol. Its IUPAC name is 4-[4-[4-(5-chloro-1H-indol-3-yl)piperidin-1-yl]butyl]-3,4-dihydro-2H-1,2-benzoxazine.
| Compound Name | 4-[4-[4-(5-chloro-1H-indol-3-yl)piperidin-1-yl]butyl]-3,4-dihydro-2H-1,2-benzoxazine |
|---|---|
| PubChem CID | 10159346 |
| Molecular Formula | C25H30ClN3O |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 4-[4-[4-(5-chloro-1H-indol-3-yl)piperidin-1-yl]butyl]-3,4-dihydro-2H-1,2-benzoxazine |
| SMILES | Clc1ccc2[nH]cc(C3CCN(CCCCC4CNOc5ccccc54)CC3)c2c1 |
| InChI | InChI=1S/C25H30ClN3O/c26-20-8-9-24-22(15-20)23(17-27-24)18-10-13-29(14-11-18)12-4-3-5-19-16-28-30-25-7-2-1-6-21(19)25/h1-2,6-9,15,17-19,27-28H,3-5,10-14,16H2 |
| InChIKey | GUQGSMDBDFZILY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|