C32H42N4O — CID 70100965
5-butoxy-3-[1-[2-[1-[4-(2-methylpropyl)phenyl]pyrazol-4-yl]ethyl]piperidin-4-yl]-1H-indole (PubChem CID 70100965) has the molecular formula C32H42N4O and a molecular weight of 498.72 g/mol. Its IUPAC name is 5-butoxy-3-[1-[2-[1-[4-(2-methylpropyl)phenyl]pyrazol-4-yl]ethyl]piperidin-4-yl]-1H-indole.
| Compound Name | 5-butoxy-3-[1-[2-[1-[4-(2-methylpropyl)phenyl]pyrazol-4-yl]ethyl]piperidin-4-yl]-1H-indole |
|---|---|
| PubChem CID | 70100965 |
| Molecular Formula | C32H42N4O |
| Molecular Weight | 498.72 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | 5-butoxy-3-[1-[2-[1-[4-(2-methylpropyl)phenyl]pyrazol-4-yl]ethyl]piperidin-4-yl]-1H-indole |
| SMILES | CCCCOc1ccc2[nH]cc(C3CCN(CCc4cnn(-c5ccc(CC(C)C)cc5)c4)CC3)c2c1 |
| InChI | InChI=1S/C32H42N4O/c1-4-5-18-37-29-10-11-32-30(20-29)31(22-33-32)27-13-16-35(17-14-27)15-12-26-21-34-36(23-26)28-8-6-25(7-9-28)19-24(2)3/h6-11,20-24,27,33H,4-5,12-19H2,1-3H3 |
| InChIKey | ZYMPPKKDESGDLP-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 46.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.72 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|