C22H23F3N2 — CID 67753310
3-[1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]-1H-indole (PubChem CID 67753310) has the molecular formula C22H23F3N2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 3-[1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]-1H-indole.
| Compound Name | 3-[1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]-1H-indole |
|---|---|
| PubChem CID | 67753310 |
| Molecular Formula | C22H23F3N2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 3-[1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]-1H-indole |
| SMILES | FC(F)(F)c1cccc(CCN2CCC(c3c[nH]c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C22H23F3N2/c23-22(24,25)18-5-3-4-16(14-18)8-11-27-12-9-17(10-13-27)20-15-26-21-7-2-1-6-19(20)21/h1-7,14-15,17,26H,8-13H2 |
| InChIKey | WANVVIHLPYUNIK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |