C29H37ClN4O5 — CID 142698764
6-[[5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]benzoyl]amino]hexylcarbamic acid (PubChem CID 142698764) has the molecular formula C29H37ClN4O5 and a molecular weight of 557.09 g/mol. Its IUPAC name is 6-[[5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]benzoyl]amino]hexylcarbamic acid.
| Compound Name | 6-[[5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]benzoyl]amino]hexylcarbamic acid |
|---|---|
| PubChem CID | 142698764 |
| Molecular Formula | C29H37ClN4O5 |
| Molecular Weight | 557.09 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 6-[[5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]benzoyl]amino]hexylcarbamic acid |
| SMILES | O=C(O)NCCCCCCNC(=O)c1cc(Cl)ccc1C1CCN(CCN2C(=O)COc3ccccc32)CC1 |
| InChI | InChI=1S/C29H37ClN4O5/c30-22-9-10-23(24(19-22)28(36)31-13-5-1-2-6-14-32-29(37)38)21-11-15-33(16-12-21)17-18-34-25-7-3-4-8-26(25)39-20-27(34)35/h3-4,7-10,19,21,32H,1-2,5-6,11-18,20H2,(H,31,36)(H,37,38) |
| InChIKey | LWNYJFBPJJJUHQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.09 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|