C33H45ClN4O4 — CID 24803987
5-chloro-N-[5-(3,3-dimethylbutanoylamino)pentyl]-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]benzamide (PubChem CID 24803987) has the molecular formula C33H45ClN4O4 and a molecular weight of 597.20 g/mol. Its IUPAC name is 5-chloro-N-[5-(3,3-dimethylbutanoylamino)pentyl]-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]benzamide.
| Compound Name | 5-chloro-N-[5-(3,3-dimethylbutanoylamino)pentyl]-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 24803987 |
| Molecular Formula | C33H45ClN4O4 |
| Molecular Weight | 597.20 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | 5-chloro-N-[5-(3,3-dimethylbutanoylamino)pentyl]-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]benzamide |
| SMILES | CC(C)(C)CC(=O)NCCCCCNC(=O)c1cc(Cl)ccc1C1CCN(CCN2C(=O)COc3ccccc32)CC1 |
| InChI | InChI=1S/C33H45ClN4O4/c1-33(2,3)22-30(39)35-15-7-4-8-16-36-32(41)27-21-25(34)11-12-26(27)24-13-17-37(18-14-24)19-20-38-28-9-5-6-10-29(28)42-23-31(38)40/h5-6,9-12,21,24H,4,7-8,13-20,22-23H2,1-3H3,(H,35,39)(H,36,41) |
| InChIKey | JRQYBSADLZUSMG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.20 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|