C36H44ClN5O4 — CID 59662196
5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]-N-[5-(2-phenylethylcarbamoylamino)pentyl]benzamide (PubChem CID 59662196) has the molecular formula C36H44ClN5O4 and a molecular weight of 646.23 g/mol. Its IUPAC name is 5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]-N-[5-(2-phenylethylcarbamoylamino)pentyl]benzamide.
| Compound Name | 5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]-N-[5-(2-phenylethylcarbamoylamino)pentyl]benzamide |
|---|---|
| PubChem CID | 59662196 |
| Molecular Formula | C36H44ClN5O4 |
| Molecular Weight | 646.23 g/mol |
| Exact Mass | 645.31 |
| IUPAC Name | 5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]-N-[5-(2-phenylethylcarbamoylamino)pentyl]benzamide |
| SMILES | O=C(NCCCCCNC(=O)c1cc(Cl)ccc1C1CCN(CCN2C(=O)COc3ccccc32)CC1)NCCc1ccccc1 |
| InChI | InChI=1S/C36H44ClN5O4/c37-29-13-14-30(28-16-21-41(22-17-28)23-24-42-32-11-5-6-12-33(32)46-26-34(42)43)31(25-29)35(44)38-18-7-2-8-19-39-36(45)40-20-15-27-9-3-1-4-10-27/h1,3-6,9-14,25,28H,2,7-8,15-24,26H2,(H,38,44)(H2,39,40,45) |
| InChIKey | KSXROKUZJQJJFR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.23 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|