C31H42ClN5O4 — CID 24803810
5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]-N-[5-(propan-2-ylcarbamoylamino)pentyl]benzamide (PubChem CID 24803810) has the molecular formula C31H42ClN5O4 and a molecular weight of 584.16 g/mol. Its IUPAC name is 5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]-N-[5-(propan-2-ylcarbamoylamino)pentyl]benzamide.
| Compound Name | 5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]-N-[5-(propan-2-ylcarbamoylamino)pentyl]benzamide |
|---|---|
| PubChem CID | 24803810 |
| Molecular Formula | C31H42ClN5O4 |
| Molecular Weight | 584.16 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]-N-[5-(propan-2-ylcarbamoylamino)pentyl]benzamide |
| SMILES | CC(C)NC(=O)NCCCCCNC(=O)c1cc(Cl)ccc1C1CCN(CCN2C(=O)COc3ccccc32)CC1 |
| InChI | InChI=1S/C31H42ClN5O4/c1-22(2)35-31(40)34-15-7-3-6-14-33-30(39)26-20-24(32)10-11-25(26)23-12-16-36(17-13-23)18-19-37-27-8-4-5-9-28(27)41-21-29(37)38/h4-5,8-11,20,22-23H,3,6-7,12-19,21H2,1-2H3,(H,33,39)(H2,34,35,40) |
| InChIKey | LLKQVYPNIVCQEX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.16 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|