C27H27F3N4O — CID 22909452
N-[3-[4-[4-(trifluoromethyl)-1H-indol-3-yl]piperidin-1-yl]propyl]quinoline-4-carboxamide (PubChem CID 22909452) has the molecular formula C27H27F3N4O and a molecular weight of 480.53 g/mol. Its IUPAC name is N-[3-[4-[4-(trifluoromethyl)-1H-indol-3-yl]piperidin-1-yl]propyl]quinoline-4-carboxamide.
| Compound Name | N-[3-[4-[4-(trifluoromethyl)-1H-indol-3-yl]piperidin-1-yl]propyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 22909452 |
| Molecular Formula | C27H27F3N4O |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | N-[3-[4-[4-(trifluoromethyl)-1H-indol-3-yl]piperidin-1-yl]propyl]quinoline-4-carboxamide |
| SMILES | O=C(NCCCN1CCC(c2c[nH]c3cccc(C(F)(F)F)c23)CC1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C27H27F3N4O/c28-27(29,30)22-6-3-8-24-25(22)21(17-33-24)18-10-15-34(16-11-18)14-4-12-32-26(35)20-9-13-31-23-7-2-1-5-19(20)23/h1-3,5-9,13,17-18,33H,4,10-12,14-16H2,(H,32,35) |
| InChIKey | MRHVLMBERYAZFC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|