C36H52ClN5O2 — CID 157151362
tert-butyl N-[3-[4-(2-cyanophenyl)piperidin-1-yl]propyl]carbamate;2-(1-butylpiperidin-4-yl)benzonitrile;hydrochloride (PubChem CID 157151362) has the molecular formula C36H52ClN5O2 and a molecular weight of 622.30 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(2-cyanophenyl)piperidin-1-yl]propyl]carbamate;2-(1-butylpiperidin-4-yl)benzonitrile;hydrochloride.
| Compound Name | tert-butyl N-[3-[4-(2-cyanophenyl)piperidin-1-yl]propyl]carbamate;2-(1-butylpiperidin-4-yl)benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 157151362 |
| Molecular Formula | C36H52ClN5O2 |
| Molecular Weight | 622.30 g/mol |
| Exact Mass | 621.38 |
| IUPAC Name | tert-butyl N-[3-[4-(2-cyanophenyl)piperidin-1-yl]propyl]carbamate;2-(1-butylpiperidin-4-yl)benzonitrile;hydrochloride |
| SMILES | CC(C)(C)OC(=O)NCCCN1CCC(c2ccccc2C#N)CC1.CCCCN1CCC(c2ccccc2C#N)CC1.Cl |
| InChI | InChI=1S/C20H29N3O2.C16H22N2.ClH/c1-20(2,3)25-19(24)22-11-6-12-23-13-9-16(10-14-23)18-8-5-4-7-17(18)15-21;1-2-3-10-18-11-8-14(9-12-18)16-7-5-4-6-15(16)13-17;/h4-5,7-8,16H,6,9-14H2,1-3H3,(H,22,24);4-7,14H,2-3,8-12H2,1H3;1H |
| InChIKey | ZCVAYCIESYSASI-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.30 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|