C19H27F3N2O2 — CID 22729485
tert-butyl N-[3-[4-(3,4,5-trifluorophenyl)piperidin-1-yl]propyl]carbamate (PubChem CID 22729485) has the molecular formula C19H27F3N2O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(3,4,5-trifluorophenyl)piperidin-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(3,4,5-trifluorophenyl)piperidin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 22729485 |
| Molecular Formula | C19H27F3N2O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | tert-butyl N-[3-[4-(3,4,5-trifluorophenyl)piperidin-1-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN1CCC(c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H27F3N2O2/c1-19(2,3)26-18(25)23-7-4-8-24-9-5-13(6-10-24)14-11-15(20)17(22)16(21)12-14/h11-13H,4-10H2,1-3H3,(H,23,25) |
| InChIKey | KOYIKDHNZNAWPX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|