C16H22F2N2O2 — CID 117116565
tert-butyl N-(2,3-difluoro-5-piperidin-4-ylphenyl)carbamate (PubChem CID 117116565) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is tert-butyl N-(2,3-difluoro-5-piperidin-4-ylphenyl)carbamate.
| Compound Name | tert-butyl N-(2,3-difluoro-5-piperidin-4-ylphenyl)carbamate |
|---|---|
| PubChem CID | 117116565 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | tert-butyl N-(2,3-difluoro-5-piperidin-4-ylphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C2CCNCC2)cc(F)c1F |
| InChI | InChI=1S/C16H22F2N2O2/c1-16(2,3)22-15(21)20-13-9-11(8-12(17)14(13)18)10-4-6-19-7-5-10/h8-10,19H,4-7H2,1-3H3,(H,20,21) |
| InChIKey | CYKUTEGQFIKLSZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |