C15H18F4N2O3 — CID 130257081
tert-butyl N-[3-[(2,3,4,5-tetrafluorobenzoyl)amino]propyl]carbamate (PubChem CID 130257081) has the molecular formula C15H18F4N2O3 and a molecular weight of 350.31 g/mol. Its IUPAC name is tert-butyl N-[3-[(2,3,4,5-tetrafluorobenzoyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2,3,4,5-tetrafluorobenzoyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 130257081 |
| Molecular Formula | C15H18F4N2O3 |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | tert-butyl N-[3-[(2,3,4,5-tetrafluorobenzoyl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H18F4N2O3/c1-15(2,3)24-14(23)21-6-4-5-20-13(22)8-7-9(16)11(18)12(19)10(8)17/h7H,4-6H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | QXQBZDDYDIWRDQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|