C15H20F2N2O4 — CID 103821830
2,4-difluoro-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]benzoic acid (PubChem CID 103821830) has the molecular formula C15H20F2N2O4 and a molecular weight of 330.33 g/mol. Its IUPAC name is 2,4-difluoro-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]benzoic acid.
| Compound Name | 2,4-difluoro-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]benzoic acid |
|---|---|
| PubChem CID | 103821830 |
| Molecular Formula | C15H20F2N2O4 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2,4-difluoro-5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCNc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C15H20F2N2O4/c1-15(2,3)23-14(22)19-6-4-5-18-12-7-9(13(20)21)10(16)8-11(12)17/h7-8,18H,4-6H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | RUEXDACBJWENRX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|