C14H20FN3O4 — CID 104932905
5-amino-2-fluoro-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]benzoic acid (PubChem CID 104932905) has the molecular formula C14H20FN3O4 and a molecular weight of 313.33 g/mol. Its IUPAC name is 5-amino-2-fluoro-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]benzoic acid.
| Compound Name | 5-amino-2-fluoro-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]benzoic acid |
|---|---|
| PubChem CID | 104932905 |
| Molecular Formula | C14H20FN3O4 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 5-amino-2-fluoro-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCCNc1cc(F)c(C(=O)O)cc1N |
| InChI | InChI=1S/C14H20FN3O4/c1-14(2,3)22-13(21)18-5-4-17-11-7-9(15)8(12(19)20)6-10(11)16/h6-7,17H,4-5,16H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | YLPNEAIPBAVCGG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|