C11H15FN2O3S — CID 113487222
5-amino-2-fluoro-4-(3-methylsulfinylpropylamino)benzoic acid (PubChem CID 113487222) has the molecular formula C11H15FN2O3S and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-amino-2-fluoro-4-(3-methylsulfinylpropylamino)benzoic acid.
| Compound Name | 5-amino-2-fluoro-4-(3-methylsulfinylpropylamino)benzoic acid |
|---|---|
| PubChem CID | 113487222 |
| Molecular Formula | C11H15FN2O3S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 5-amino-2-fluoro-4-(3-methylsulfinylpropylamino)benzoic acid |
| SMILES | CS(=O)CCCNc1cc(F)c(C(=O)O)cc1N |
| InChI | InChI=1S/C11H15FN2O3S/c1-18(17)4-2-3-14-10-6-8(12)7(11(15)16)5-9(10)13/h5-6,14H,2-4,13H2,1H3,(H,15,16) |
| InChIKey | OCGDPGKQICUBTK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|