C12H13FINO4 — CID 171463811
2-fluoro-5-iodo-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (PubChem CID 171463811) has the molecular formula C12H13FINO4 and a molecular weight of 381.14 g/mol. Its IUPAC name is 2-fluoro-5-iodo-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid.
| Compound Name | 2-fluoro-5-iodo-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
|---|---|
| PubChem CID | 171463811 |
| Molecular Formula | C12H13FINO4 |
| Molecular Weight | 381.14 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 2-fluoro-5-iodo-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| SMILES | CC(C)(C)OC(=O)Nc1cc(F)c(C(=O)O)cc1I |
| InChI | InChI=1S/C12H13FINO4/c1-12(2,3)19-11(18)15-9-5-7(13)6(10(16)17)4-8(9)14/h4-5H,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | AXGWUCYKCZCTNB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.14 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|