C17H21F4NO4 — CID 22598993
(2,3,5,6-tetrafluorophenyl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 22598993) has the molecular formula C17H21F4NO4 and a molecular weight of 379.35 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 22598993 |
| Molecular Formula | C17H21F4NO4 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C17H21F4NO4/c1-17(2,3)26-16(24)22-8-6-4-5-7-12(23)25-15-13(20)10(18)9-11(19)14(15)21/h9H,4-8H2,1-3H3,(H,22,24) |
| InChIKey | ARJKLMNACWZSFB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|