C17H23F4NO4S2 — CID 165406958
(2,3,5,6-tetrafluorophenyl) 6-[3-[dimethyl(sulfanyloxy)-λ4-sulfanyl]propylamino]-6-oxohexanoate (PubChem CID 165406958) has the molecular formula C17H23F4NO4S2 and a molecular weight of 445.50 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 6-[3-[dimethyl(sulfanyloxy)-λ4-sulfanyl]propylamino]-6-oxohexanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 6-[3-[dimethyl(sulfanyloxy)-λ4-sulfanyl]propylamino]-6-oxohexanoate |
|---|---|
| PubChem CID | 165406958 |
| Molecular Formula | C17H23F4NO4S2 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 6-[3-[dimethyl(sulfanyloxy)-λ4-sulfanyl]propylamino]-6-oxohexanoate |
| SMILES | CS(C)(CCCNC(=O)CCCCC(=O)Oc1c(F)c(F)cc(F)c1F)OS |
| InChI | InChI=1S/C17H23F4NO4S2/c1-28(2,26-27)9-5-8-22-13(23)6-3-4-7-14(24)25-17-15(20)11(18)10-12(19)16(17)21/h10,27H,3-9H2,1-2H3,(H,22,23) |
| InChIKey | YYQVSWRQAUNZKL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|