C9H6F4O2S — CID 59031857
(2,3,5,6-tetrafluorophenyl) 3-sulfanylpropanoate (PubChem CID 59031857) has the molecular formula C9H6F4O2S and a molecular weight of 254.20 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 3-sulfanylpropanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 59031857 |
| Molecular Formula | C9H6F4O2S |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 3-sulfanylpropanoate |
| SMILES | O=C(CCS)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C9H6F4O2S/c10-4-3-5(11)8(13)9(7(4)12)15-6(14)1-2-16/h3,16H,1-2H2 |
| InChIKey | FYOHNSUWRXDZDD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|