C14H9F4NO2 — CID 166148966
(2,3,5,6-tetrafluorophenyl) 3-pyridin-3-ylpropanoate (PubChem CID 166148966) has the molecular formula C14H9F4NO2 and a molecular weight of 299.22 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 3-pyridin-3-ylpropanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 166148966 |
| Molecular Formula | C14H9F4NO2 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 3-pyridin-3-ylpropanoate |
| SMILES | O=C(CCc1cccnc1)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C14H9F4NO2/c15-9-6-10(16)13(18)14(12(9)17)21-11(20)4-3-8-2-1-5-19-7-8/h1-2,5-7H,3-4H2 |
| InChIKey | FYLXQVDMZJERJH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|