C19H16F4N2O3 — CID 138680447
2-(3-pyridin-3-ylpropanoyl)-4-(2,3,5,6-tetrafluorophenyl)pyrrolidine-1-carboxylic acid (PubChem CID 138680447) has the molecular formula C19H16F4N2O3 and a molecular weight of 396.34 g/mol. Its IUPAC name is 2-(3-pyridin-3-ylpropanoyl)-4-(2,3,5,6-tetrafluorophenyl)pyrrolidine-1-carboxylic acid.
| Compound Name | 2-(3-pyridin-3-ylpropanoyl)-4-(2,3,5,6-tetrafluorophenyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 138680447 |
| Molecular Formula | C19H16F4N2O3 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-(3-pyridin-3-ylpropanoyl)-4-(2,3,5,6-tetrafluorophenyl)pyrrolidine-1-carboxylic acid |
| SMILES | O=C(CCc1cccnc1)C1CC(c2c(F)c(F)cc(F)c2F)CN1C(=O)O |
| InChI | InChI=1S/C19H16F4N2O3/c20-12-7-13(21)18(23)16(17(12)22)11-6-14(25(9-11)19(27)28)15(26)4-3-10-2-1-5-24-8-10/h1-2,5,7-8,11,14H,3-4,6,9H2,(H,27,28) |
| InChIKey | BZNYNWQEAOMJNI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|