C24H24F5NO5 — CID 169059134
benzyl 6-[[5-oxo-5-(2,3,4,5,6-pentafluorophenoxy)pentanoyl]amino]hexanoate (PubChem CID 169059134) has the molecular formula C24H24F5NO5 and a molecular weight of 501.45 g/mol. Its IUPAC name is benzyl 6-[[5-oxo-5-(2,3,4,5,6-pentafluorophenoxy)pentanoyl]amino]hexanoate.
| Compound Name | benzyl 6-[[5-oxo-5-(2,3,4,5,6-pentafluorophenoxy)pentanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 169059134 |
| Molecular Formula | C24H24F5NO5 |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | benzyl 6-[[5-oxo-5-(2,3,4,5,6-pentafluorophenoxy)pentanoyl]amino]hexanoate |
| SMILES | O=C(CCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)NCCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H24F5NO5/c25-19-20(26)22(28)24(23(29)21(19)27)35-18(33)12-7-10-16(31)30-13-6-2-5-11-17(32)34-14-15-8-3-1-4-9-15/h1,3-4,8-9H,2,5-7,10-14H2,(H,30,31) |
| InChIKey | BSJNKYTVNYENSE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|