C18H14F5NO4 — CID 57060376
(2,3,4,5,6-pentafluorophenyl) 4-(phenylmethoxycarbonylamino)butanoate (PubChem CID 57060376) has the molecular formula C18H14F5NO4 and a molecular weight of 403.30 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 57060376 |
| Molecular Formula | C18H14F5NO4 |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-(phenylmethoxycarbonylamino)butanoate |
| SMILES | O=C(CCCNC(=O)OCc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H14F5NO4/c19-12-13(20)15(22)17(16(23)14(12)21)28-11(25)7-4-8-24-18(26)27-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,24,26) |
| InChIKey | KTYKHIJFSZMDKI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|