C14H17Br2NO4 — CID 129396366
[(1R)-1,2-dibromoethyl] 4-(phenylmethoxycarbonylamino)butanoate (PubChem CID 129396366) has the molecular formula C14H17Br2NO4 and a molecular weight of 423.10 g/mol. Its IUPAC name is [(1R)-1,2-dibromoethyl] 4-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | [(1R)-1,2-dibromoethyl] 4-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 129396366 |
| Molecular Formula | C14H17Br2NO4 |
| Molecular Weight | 423.10 g/mol |
| Exact Mass | 420.95 |
| IUPAC Name | [(1R)-1,2-dibromoethyl] 4-(phenylmethoxycarbonylamino)butanoate |
| SMILES | O=C(CCCNC(=O)OCc1ccccc1)O[C@H](Br)CBr |
| InChI | InChI=1S/C14H17Br2NO4/c15-9-12(16)21-13(18)7-4-8-17-14(19)20-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,17,19)/t12-/m0/s1 |
| InChIKey | KAMAQVPHKJVWFR-LBPRGKRZSA-N |
| XLogP | 3.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.10 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|